C20H18FNO4 — CID 118550949
(4R)-4-benzyl-3-[(Z)-2-fluoro-3-(4-methoxyphenyl)prop-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 118550949) has the molecular formula C20H18FNO4 and a molecular weight of 355.37 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(Z)-2-fluoro-3-(4-methoxyphenyl)prop-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(Z)-2-fluoro-3-(4-methoxyphenyl)prop-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 118550949 |
| Molecular Formula | C20H18FNO4 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | (4R)-4-benzyl-3-[(Z)-2-fluoro-3-(4-methoxyphenyl)prop-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(/C=C(\F)C(=O)N2C(=O)OC[C@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H18FNO4/c1-25-17-9-7-15(8-10-17)12-18(21)19(23)22-16(13-26-20(22)24)11-14-5-3-2-4-6-14/h2-10,12,16H,11,13H2,1H3/b18-12-/t16-/m1/s1 |
| InChIKey | HOHWCZZVMWMLQY-UWCCDQBKSA-N |
| XLogP | 3.60 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|