C13H17FN2 — CID 118554911
(Z)-1-(4-fluorophenyl)-1-imino-2,4-dimethylpent-2-en-3-amine (PubChem CID 118554911) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is (Z)-1-(4-fluorophenyl)-1-imino-2,4-dimethylpent-2-en-3-amine.
| Compound Name | (Z)-1-(4-fluorophenyl)-1-imino-2,4-dimethylpent-2-en-3-amine |
|---|---|
| PubChem CID | 118554911 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | (Z)-1-(4-fluorophenyl)-1-imino-2,4-dimethylpent-2-en-3-amine |
| SMILES | [H]/N=C(C(\C)=C(/N)C(C)C)/c1ccc(F)cc1 |
| InChI | InChI=1S/C13H17FN2/c1-8(2)12(15)9(3)13(16)10-4-6-11(14)7-5-10/h4-8,16H,15H2,1-3H3/b12-9-,16-13+ |
| InChIKey | AMZRTEKOUVMTPR-RPEIIFLXSA-N |
| XLogP | 3.08 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|