About 2-imino-2-(4-sulfanylphenyl)acetamide;methanamine
2-imino-2-(4-sulfanylphenyl)acetamide;methanamine (PubChem CID 143392409) has the molecular formula C9H13N3OS
and a molecular weight of 211.29 g/mol. Its IUPAC name is 2-imino-2-(4-sulfanylphenyl)acetamide;methanamine.
Molecular Properties
| Compound Name | 2-imino-2-(4-sulfanylphenyl)acetamide;methanamine |
| PubChem CID | 143392409 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-imino-2-(4-sulfanylphenyl)acetamide;methanamine |
| SMILES | CN.[H]/N=C(\C(N)=O)c1ccc(S)cc1 |
| InChI | InChI=1S/C8H8N2OS.CH5N/c9-7(8(10)11)5-1-3-6(12)4-2-5;1-2/h1-4,9,12H,(H2,10,11);2H2,1H3/b9-7-; |
| InChIKey | AJKPUHTYMSWDMK-VILQZVERSA-N |
| XLogP | 0.40 |
| TPSA | 92.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-imino-2-(4-sulfanylphenyl)acetamide;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-2-(4-sulfanylphenyl)acetamide;methanamine?
The IUPAC name of 2-imino-2-(4-sulfanylphenyl)acetamide;methanamine (CID 143392409) is 2-imino-2-(4-sulfanylphenyl)acetamide;methanamine.
What is the SMILES notation for 2-imino-2-(4-sulfanylphenyl)acetamide;methanamine?
The canonical SMILES for 2-imino-2-(4-sulfanylphenyl)acetamide;methanamine is CN.[H]/N=C(\C(N)=O)c1ccc(S)cc1.
What is the InChIKey of 2-imino-2-(4-sulfanylphenyl)acetamide;methanamine?
The InChIKey is AJKPUHTYMSWDMK-VILQZVERSA-N. The full InChI is InChI=1S/C8H8N2OS.CH5N/c9-7(8(10)11)5-1-3-6(12)4-2-5;1-2/h1-4,9,12H,(H2,10,11);2H2,1H3/b9-7-;.
What are the key properties of 2-imino-2-(4-sulfanylphenyl)acetamide;methanamine?
2-imino-2-(4-sulfanylphenyl)acetamide;methanamine has a molecular weight of 211.29 g/mol, XLogP of 0.40, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-2-(4-sulfanylphenyl)acetamide;methanamine is sourced from PubChem (CID 143392409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).