C7H11F2NO2 — CID 118555978
(1S)-3,3-difluoro-1-hydroxycyclohexane-1-carboxamide (PubChem CID 118555978) has the molecular formula C7H11F2NO2 and a molecular weight of 179.17 g/mol. Its IUPAC name is (1S)-3,3-difluoro-1-hydroxycyclohexane-1-carboxamide.
| Compound Name | (1S)-3,3-difluoro-1-hydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 118555978 |
| Molecular Formula | C7H11F2NO2 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | (1S)-3,3-difluoro-1-hydroxycyclohexane-1-carboxamide |
| SMILES | NC(=O)[C@]1(O)CCCC(F)(F)C1 |
| InChI | InChI=1S/C7H11F2NO2/c8-7(9)3-1-2-6(12,4-7)5(10)11/h12H,1-4H2,(H2,10,11)/t6-/m0/s1 |
| InChIKey | WIDDBWHEIOCNQT-LURJTMIESA-N |
| XLogP | 0.41 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |