C23H17F3N6O3 — CID 118556260
(5R)-5-[4-cyano-2-(1,2-dihydroxyethyl)phenyl]-7-methyl-3-oxo-8-[3-(trifluoromethyl)phenyl]-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidine-6-carbonitrile (PubChem CID 118556260) has the molecular formula C23H17F3N6O3 and a molecular weight of 482.42 g/mol. Its IUPAC name is (5R)-5-[4-cyano-2-(1,2-dihydroxyethyl)phenyl]-7-methyl-3-oxo-8-[3-(trifluoromethyl)phenyl]-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidine-6-carbonitrile.
| Compound Name | (5R)-5-[4-cyano-2-(1,2-dihydroxyethyl)phenyl]-7-methyl-3-oxo-8-[3-(trifluoromethyl)phenyl]-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 118556260 |
| Molecular Formula | C23H17F3N6O3 |
| Molecular Weight | 482.42 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | (5R)-5-[4-cyano-2-(1,2-dihydroxyethyl)phenyl]-7-methyl-3-oxo-8-[3-(trifluoromethyl)phenyl]-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidine-6-carbonitrile |
| SMILES | CC1=C(C#N)[C@@H](c2ccc(C#N)cc2C(O)CO)n2c(n[nH]c2=O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H17F3N6O3/c1-12-18(10-28)20(16-6-5-13(9-27)7-17(16)19(34)11-33)32-21(29-30-22(32)35)31(12)15-4-2-3-14(8-15)23(24,25)26/h2-8,19-20,33-34H,11H2,1H3,(H,30,35)/t19?,20-/m1/s1 |
| InChIKey | NDJVLXMKFNWGTB-GFOWMXPYSA-N |
| XLogP | 3.03 |
| TPSA | 141.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |