C22H20F2N6O3 — CID 166690291
4-[(5S)-6-amino-8-[3-(difluoromethyl)phenyl]-7-methyl-3-oxo-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidin-5-yl]-3-(1,2-dihydroxyethyl)benzonitrile (PubChem CID 166690291) has the molecular formula C22H20F2N6O3 and a molecular weight of 454.44 g/mol. Its IUPAC name is 4-[(5S)-6-amino-8-[3-(difluoromethyl)phenyl]-7-methyl-3-oxo-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidin-5-yl]-3-(1,2-dihydroxyethyl)benzonitrile.
| Compound Name | 4-[(5S)-6-amino-8-[3-(difluoromethyl)phenyl]-7-methyl-3-oxo-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidin-5-yl]-3-(1,2-dihydroxyethyl)benzonitrile |
|---|---|
| PubChem CID | 166690291 |
| Molecular Formula | C22H20F2N6O3 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 4-[(5S)-6-amino-8-[3-(difluoromethyl)phenyl]-7-methyl-3-oxo-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidin-5-yl]-3-(1,2-dihydroxyethyl)benzonitrile |
| SMILES | CC1=C(N)[C@H](c2ccc(C#N)cc2C(O)CO)n2c(n[nH]c2=O)N1c1cccc(C(F)F)c1 |
| InChI | InChI=1S/C22H20F2N6O3/c1-11-18(26)19(15-6-5-12(9-25)7-16(15)17(32)10-31)30-21(27-28-22(30)33)29(11)14-4-2-3-13(8-14)20(23)24/h2-8,17,19-20,31-32H,10,26H2,1H3,(H,28,33)/t17?,19-/m0/s1 |
| InChIKey | PQKNTVNCSYDGSO-NNBQYGFHSA-N |
| XLogP | 2.34 |
| TPSA | 144.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |