C22H24F2N6O2 — CID 166690295
4-[(4S)-5-amino-3-[amino(hydroxy)methyl]-1-[3-(difluoromethyl)phenyl]-2-imino-6-methyl-4H-pyrimidin-4-yl]-3-(2-hydroxyethyl)benzonitrile (PubChem CID 166690295) has the molecular formula C22H24F2N6O2 and a molecular weight of 442.47 g/mol. Its IUPAC name is 4-[(4S)-5-amino-3-[amino(hydroxy)methyl]-1-[3-(difluoromethyl)phenyl]-2-imino-6-methyl-4H-pyrimidin-4-yl]-3-(2-hydroxyethyl)benzonitrile.
| Compound Name | 4-[(4S)-5-amino-3-[amino(hydroxy)methyl]-1-[3-(difluoromethyl)phenyl]-2-imino-6-methyl-4H-pyrimidin-4-yl]-3-(2-hydroxyethyl)benzonitrile |
|---|---|
| PubChem CID | 166690295 |
| Molecular Formula | C22H24F2N6O2 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 4-[(4S)-5-amino-3-[amino(hydroxy)methyl]-1-[3-(difluoromethyl)phenyl]-2-imino-6-methyl-4H-pyrimidin-4-yl]-3-(2-hydroxyethyl)benzonitrile |
| SMILES | [H]/N=C1/N(c2cccc(C(F)F)c2)C(C)=C(N)[C@H](c2ccc(C#N)cc2CCO)N1C(N)O |
| InChI | InChI=1S/C22H24F2N6O2/c1-12-18(26)19(17-6-5-13(11-25)9-14(17)7-8-31)30(22(28)32)21(27)29(12)16-4-2-3-15(10-16)20(23)24/h2-6,9-10,19-20,22,27,31-32H,7-8,26,28H2,1H3/b27-21-/t19-,22?/m0/s1 |
| InChIKey | QEYDKQLSUNCFPG-JFJGONGESA-N |
| XLogP | 2.25 |
| TPSA | 146.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|