C25H23BrF3N5O3 — CID 166690419
methyl 4-[2-(3-bromopropyl)-4-cyanophenyl]-3-carbamoyl-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate (PubChem CID 166690419) has the molecular formula C25H23BrF3N5O3 and a molecular weight of 578.39 g/mol. Its IUPAC name is methyl 4-[2-(3-bromopropyl)-4-cyanophenyl]-3-carbamoyl-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate.
| Compound Name | methyl 4-[2-(3-bromopropyl)-4-cyanophenyl]-3-carbamoyl-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 166690419 |
| Molecular Formula | C25H23BrF3N5O3 |
| Molecular Weight | 578.39 g/mol |
| Exact Mass | 577.09 |
| IUPAC Name | methyl 4-[2-(3-bromopropyl)-4-cyanophenyl]-3-carbamoyl-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate |
| SMILES | [H]/N=C1/N(c2cccc(C(F)(F)F)c2)C(C)=C(C(=O)OC)C(c2ccc(C#N)cc2CCCBr)N1C(N)=O |
| InChI | InChI=1S/C25H23BrF3N5O3/c1-14-20(22(35)37-2)21(19-9-8-15(13-30)11-16(19)5-4-10-26)34(24(32)36)23(31)33(14)18-7-3-6-17(12-18)25(27,28)29/h3,6-9,11-12,21,31H,4-5,10H2,1-2H3,(H2,32,36)/b31-23- |
| InChIKey | XQGUNWMMAKMVOT-SXBRIOAWSA-N |
| XLogP | 5.23 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.39 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|