C30H36F3N6O6+ — CID 144648992
2-[2-[(4R)-3-carbamoyl-2-imino-5-methoxycarbonyl-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidin-4-yl]-5-cyanophenyl]ethyl-(2-hydroxyethyl)-dimethylazanium;methyl formate (PubChem CID 144648992) has the molecular formula C30H36F3N6O6+ and a molecular weight of 633.65 g/mol. Its IUPAC name is 2-[2-[(4R)-3-carbamoyl-2-imino-5-methoxycarbonyl-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidin-4-yl]-5-cyanophenyl]ethyl-(2-hydroxyethyl)-dimethylazanium;methyl formate.
| Compound Name | 2-[2-[(4R)-3-carbamoyl-2-imino-5-methoxycarbonyl-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidin-4-yl]-5-cyanophenyl]ethyl-(2-hydroxyethyl)-dimethylazanium;methyl formate |
|---|---|
| PubChem CID | 144648992 |
| Molecular Formula | C30H36F3N6O6+ |
| Molecular Weight | 633.65 g/mol |
| Exact Mass | 633.26 |
| IUPAC Name | 2-[2-[(4R)-3-carbamoyl-2-imino-5-methoxycarbonyl-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidin-4-yl]-5-cyanophenyl]ethyl-(2-hydroxyethyl)-dimethylazanium;methyl formate |
| SMILES | COC=O.[H]/N=C1/N(c2cccc(C(F)(F)F)c2)C(C)=C(C(=O)OC)[C@@H](c2ccc(C#N)cc2CC[N+](C)(C)CCO)N1C(N)=O |
| InChI | InChI=1S/C28H31F3N6O4.C2H4O2/c1-17-23(25(39)41-4)24(22-9-8-18(16-32)14-19(22)10-11-37(2,3)12-13-38)36(27(34)40)26(33)35(17)21-7-5-6-20(15-21)28(29,30)31;1-4-2-3/h5-9,14-15,24,33,38H,10-13H2,1-4H3,(H-,34,40);2H,1H3/p+1/b33-26-;/t24-;/m1./s1 |
| InChIKey | NEKYRBXLUAMEES-VJUVMQNWSA-O |
| XLogP | 3.30 |
| TPSA | 170.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.65 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|