C31H36F3N6O4+ — CID 144648887
methyl (4R)-3-carbamoyl-4-[4-cyano-2-[4-(4-methylmorpholin-4-ium-4-yl)butyl]phenyl]-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate (PubChem CID 144648887) has the molecular formula C31H36F3N6O4+ and a molecular weight of 613.66 g/mol. Its IUPAC name is methyl (4R)-3-carbamoyl-4-[4-cyano-2-[4-(4-methylmorpholin-4-ium-4-yl)butyl]phenyl]-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate.
| Compound Name | methyl (4R)-3-carbamoyl-4-[4-cyano-2-[4-(4-methylmorpholin-4-ium-4-yl)butyl]phenyl]-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 144648887 |
| Molecular Formula | C31H36F3N6O4+ |
| Molecular Weight | 613.66 g/mol |
| Exact Mass | 613.27 |
| IUPAC Name | methyl (4R)-3-carbamoyl-4-[4-cyano-2-[4-(4-methylmorpholin-4-ium-4-yl)butyl]phenyl]-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate |
| SMILES | [H]/N=C1/N(c2cccc(C(F)(F)F)c2)C(C)=C(C(=O)OC)[C@@H](c2ccc(C#N)cc2CCCC[N+]2(C)CCOCC2)N1C(N)=O |
| InChI | InChI=1S/C31H35F3N6O4/c1-20-26(28(41)43-3)27(39(30(37)42)29(36)38(20)24-9-6-8-23(18-24)31(32,33)34)25-11-10-21(19-35)17-22(25)7-4-5-12-40(2)13-15-44-16-14-40/h6,8-11,17-18,27,36H,4-5,7,12-16H2,1-3H3,(H-,37,42)/p+1/b36-29-/t27-/m1/s1 |
| InChIKey | JBSBBEIAWYCIBB-ZUXSQVOTSA-O |
| XLogP | 4.70 |
| TPSA | 132.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.66 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|