C29H34F3N6O4+ — CID 144649026
methyl (4R)-3-carbamoyl-4-[(3E,5E)-6-cyano-1-(4-methylmorpholin-4-ium-4-yl)octa-3,5,7-trien-3-yl]-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate (PubChem CID 144649026) has the molecular formula C29H34F3N6O4+ and a molecular weight of 587.62 g/mol. Its IUPAC name is methyl (4R)-3-carbamoyl-4-[(3E,5E)-6-cyano-1-(4-methylmorpholin-4-ium-4-yl)octa-3,5,7-trien-3-yl]-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate.
| Compound Name | methyl (4R)-3-carbamoyl-4-[(3E,5E)-6-cyano-1-(4-methylmorpholin-4-ium-4-yl)octa-3,5,7-trien-3-yl]-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 144649026 |
| Molecular Formula | C29H34F3N6O4+ |
| Molecular Weight | 587.62 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | methyl (4R)-3-carbamoyl-4-[(3E,5E)-6-cyano-1-(4-methylmorpholin-4-ium-4-yl)octa-3,5,7-trien-3-yl]-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate |
| SMILES | [H]/N=C1/N(c2cccc(C(F)(F)F)c2)C(C)=C(C(=O)OC)[C@@H](/C(=C/C=C(/C#N)C=C)CC[N+]2(C)CCOCC2)N1C(N)=O |
| InChI | InChI=1S/C29H33F3N6O4/c1-5-20(18-33)9-10-21(11-12-38(3)13-15-42-16-14-38)25-24(26(39)41-4)19(2)36(27(34)37(25)28(35)40)23-8-6-7-22(17-23)29(30,31)32/h5-10,17,25,34H,1,11-16H2,2-4H3,(H-,35,40)/p+1/b20-9+,21-10+,34-27-/t25-/m1/s1 |
| InChIKey | RZUBXEHIWSEKRL-GLWMGUGTSA-O |
| XLogP | 4.09 |
| TPSA | 132.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.62 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|