C25H26F3N7O4 — CID 166690350
methyl (4S)-3-carbamoyl-4-[(1Z,3E)-4-cyano-1-(ethylcarbamoylamino)hexa-1,3,5-trienyl]-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate (PubChem CID 166690350) has the molecular formula C25H26F3N7O4 and a molecular weight of 545.52 g/mol. Its IUPAC name is methyl (4S)-3-carbamoyl-4-[(1Z,3E)-4-cyano-1-(ethylcarbamoylamino)hexa-1,3,5-trienyl]-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate.
| Compound Name | methyl (4S)-3-carbamoyl-4-[(1Z,3E)-4-cyano-1-(ethylcarbamoylamino)hexa-1,3,5-trienyl]-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 166690350 |
| Molecular Formula | C25H26F3N7O4 |
| Molecular Weight | 545.52 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | methyl (4S)-3-carbamoyl-4-[(1Z,3E)-4-cyano-1-(ethylcarbamoylamino)hexa-1,3,5-trienyl]-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate |
| SMILES | [H]/N=C1/N(c2cccc(C(F)(F)F)c2)C(C)=C(C(=O)OC)[C@@H](/C(=C/C=C(/C#N)C=C)NC(=O)NCC)N1C(N)=O |
| InChI | InChI=1S/C25H26F3N7O4/c1-5-15(13-29)10-11-18(33-24(38)32-6-2)20-19(21(36)39-4)14(3)34(22(30)35(20)23(31)37)17-9-7-8-16(12-17)25(26,27)28/h5,7-12,20,30H,1,6H2,2-4H3,(H2,31,37)(H2,32,33,38)/b15-10+,18-11-,30-22-/t20-/m1/s1 |
| InChIKey | KNPNYNROHYMIIT-CUXOZGLNSA-N |
| XLogP | 3.50 |
| TPSA | 164.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|