C23H20F3N5O4 — CID 144648835
methyl 3-carbamoyl-4-[(2Z,4E)-5-cyano-1-oxohepta-2,4,6-trien-2-yl]-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate (PubChem CID 144648835) has the molecular formula C23H20F3N5O4 and a molecular weight of 487.44 g/mol. Its IUPAC name is methyl 3-carbamoyl-4-[(2Z,4E)-5-cyano-1-oxohepta-2,4,6-trien-2-yl]-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate.
| Compound Name | methyl 3-carbamoyl-4-[(2Z,4E)-5-cyano-1-oxohepta-2,4,6-trien-2-yl]-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 144648835 |
| Molecular Formula | C23H20F3N5O4 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | methyl 3-carbamoyl-4-[(2Z,4E)-5-cyano-1-oxohepta-2,4,6-trien-2-yl]-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate |
| SMILES | [H]/N=C1/N(c2cccc(C(F)(F)F)c2)C(C)=C(C(=O)OC)C(/C(C=O)=C/C=C(/C#N)C=C)N1C(N)=O |
| InChI | InChI=1S/C23H20F3N5O4/c1-4-14(11-27)8-9-15(12-32)19-18(20(33)35-3)13(2)30(21(28)31(19)22(29)34)17-7-5-6-16(10-17)23(24,25)26/h4-10,12,19,28H,1H2,2-3H3,(H2,29,34)/b14-8+,15-9+,28-21- |
| InChIKey | BEHXJPSUALFZOX-CHCNXWDJSA-N |
| XLogP | 3.42 |
| TPSA | 140.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|