C24H22F3N5O5 — CID 166690446
(3E,5E)-3-[(4R)-3-carbamoyl-2-imino-5-methoxycarbonyl-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidin-4-yl]-6-cyanoocta-3,5,7-trienoic acid (PubChem CID 166690446) has the molecular formula C24H22F3N5O5 and a molecular weight of 517.46 g/mol. Its IUPAC name is (3E,5E)-3-[(4R)-3-carbamoyl-2-imino-5-methoxycarbonyl-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidin-4-yl]-6-cyanoocta-3,5,7-trienoic acid.
| Compound Name | (3E,5E)-3-[(4R)-3-carbamoyl-2-imino-5-methoxycarbonyl-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidin-4-yl]-6-cyanoocta-3,5,7-trienoic acid |
|---|---|
| PubChem CID | 166690446 |
| Molecular Formula | C24H22F3N5O5 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | (3E,5E)-3-[(4R)-3-carbamoyl-2-imino-5-methoxycarbonyl-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidin-4-yl]-6-cyanoocta-3,5,7-trienoic acid |
| SMILES | [H]/N=C1/N(c2cccc(C(F)(F)F)c2)C(C)=C(C(=O)OC)[C@@H](/C(=C/C=C(/C#N)C=C)CC(=O)O)N1C(N)=O |
| InChI | InChI=1S/C24H22F3N5O5/c1-4-14(12-28)8-9-15(10-18(33)34)20-19(21(35)37-3)13(2)31(22(29)32(20)23(30)36)17-7-5-6-16(11-17)24(25,26)27/h4-9,11,20,29H,1,10H2,2-3H3,(H2,30,36)(H,33,34)/b14-8+,15-9+,29-22-/t20-/m1/s1 |
| InChIKey | WQRVJCKWMBWZNZ-VAMCYOFJSA-N |
| XLogP | 3.69 |
| TPSA | 160.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|