C23H22F3N5O4 — CID 166690418
methyl (4S)-3-carbamoyl-4-[(1Z,3E)-4-cyano-1-methoxyhexa-1,3,5-trienyl]-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate (PubChem CID 166690418) has the molecular formula C23H22F3N5O4 and a molecular weight of 489.45 g/mol. Its IUPAC name is methyl (4S)-3-carbamoyl-4-[(1Z,3E)-4-cyano-1-methoxyhexa-1,3,5-trienyl]-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate.
| Compound Name | methyl (4S)-3-carbamoyl-4-[(1Z,3E)-4-cyano-1-methoxyhexa-1,3,5-trienyl]-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 166690418 |
| Molecular Formula | C23H22F3N5O4 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | methyl (4S)-3-carbamoyl-4-[(1Z,3E)-4-cyano-1-methoxyhexa-1,3,5-trienyl]-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate |
| SMILES | [H]/N=C1/N(c2cccc(C(F)(F)F)c2)C(C)=C(C(=O)OC)[C@@H](/C(=C/C=C(/C#N)C=C)OC)N1C(N)=O |
| InChI | InChI=1S/C23H22F3N5O4/c1-5-14(12-27)9-10-17(34-3)19-18(20(32)35-4)13(2)30(21(28)31(19)22(29)33)16-8-6-7-15(11-16)23(24,25)26/h5-11,19,28H,1H2,2-4H3,(H2,29,33)/b14-9+,17-10-,28-21-/t19-/m1/s1 |
| InChIKey | OFABJNBIBCLACN-QLWNRLCBSA-N |
| XLogP | 3.82 |
| TPSA | 132.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|