C21H17BrF3N5O3 — CID 166690432
(4S)-4-[(1Z,3E)-1-bromo-4-cyanohexa-1,3,5-trienyl]-3-carbamoyl-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylic acid (PubChem CID 166690432) has the molecular formula C21H17BrF3N5O3 and a molecular weight of 524.30 g/mol. Its IUPAC name is (4S)-4-[(1Z,3E)-1-bromo-4-cyanohexa-1,3,5-trienyl]-3-carbamoyl-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylic acid.
| Compound Name | (4S)-4-[(1Z,3E)-1-bromo-4-cyanohexa-1,3,5-trienyl]-3-carbamoyl-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 166690432 |
| Molecular Formula | C21H17BrF3N5O3 |
| Molecular Weight | 524.30 g/mol |
| Exact Mass | 523.05 |
| IUPAC Name | (4S)-4-[(1Z,3E)-1-bromo-4-cyanohexa-1,3,5-trienyl]-3-carbamoyl-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylic acid |
| SMILES | [H]/N=C1/N(c2cccc(C(F)(F)F)c2)C(C)=C(C(=O)O)[C@@H](/C(Br)=C/C=C(/C#N)C=C)N1C(N)=O |
| InChI | InChI=1S/C21H17BrF3N5O3/c1-3-12(10-26)7-8-15(22)17-16(18(31)32)11(2)29(19(27)30(17)20(28)33)14-6-4-5-13(9-14)21(23,24)25/h3-9,17,27H,1H2,2H3,(H2,28,33)(H,31,32)/b12-7+,15-8-,27-19-/t17-/m1/s1 |
| InChIKey | LKDSHQPQHWQWJC-DFUNJZPKSA-N |
| XLogP | 4.48 |
| TPSA | 134.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.30 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|