C26H27F3N6O3 — CID 144552650
methyl 4-(4-cyanophenyl)-2-imino-6-methyl-3-[3-(methylamino)propylcarbamoyl]-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate (PubChem CID 144552650) has the molecular formula C26H27F3N6O3 and a molecular weight of 528.54 g/mol. Its IUPAC name is methyl 4-(4-cyanophenyl)-2-imino-6-methyl-3-[3-(methylamino)propylcarbamoyl]-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate.
| Compound Name | methyl 4-(4-cyanophenyl)-2-imino-6-methyl-3-[3-(methylamino)propylcarbamoyl]-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 144552650 |
| Molecular Formula | C26H27F3N6O3 |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | methyl 4-(4-cyanophenyl)-2-imino-6-methyl-3-[3-(methylamino)propylcarbamoyl]-1-[3-(trifluoromethyl)phenyl]-4H-pyrimidine-5-carboxylate |
| SMILES | [H]/N=C1/N(c2cccc(C(F)(F)F)c2)C(C)=C(C(=O)OC)C(c2ccc(C#N)cc2)N1C(=O)NCCCNC |
| InChI | InChI=1S/C26H27F3N6O3/c1-16-21(23(36)38-3)22(18-10-8-17(15-30)9-11-18)35(25(37)33-13-5-12-32-2)24(31)34(16)20-7-4-6-19(14-20)26(27,28)29/h4,6-11,14,22,31-32H,5,12-13H2,1-3H3,(H,33,37)/b31-24- |
| InChIKey | WBLRKTVBCZQPSI-QLTSDVKISA-N |
| XLogP | 4.14 |
| TPSA | 121.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|