C23H18F2N6O3 — CID 118556303
5-[4-cyano-2-(1,2-dihydroxyethyl)phenyl]-8-[3-(difluoromethyl)phenyl]-7-methyl-3-oxo-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidine-6-carbonitrile (PubChem CID 118556303) has the molecular formula C23H18F2N6O3 and a molecular weight of 464.43 g/mol. Its IUPAC name is 5-[4-cyano-2-(1,2-dihydroxyethyl)phenyl]-8-[3-(difluoromethyl)phenyl]-7-methyl-3-oxo-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidine-6-carbonitrile.
| Compound Name | 5-[4-cyano-2-(1,2-dihydroxyethyl)phenyl]-8-[3-(difluoromethyl)phenyl]-7-methyl-3-oxo-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 118556303 |
| Molecular Formula | C23H18F2N6O3 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 5-[4-cyano-2-(1,2-dihydroxyethyl)phenyl]-8-[3-(difluoromethyl)phenyl]-7-methyl-3-oxo-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidine-6-carbonitrile |
| SMILES | CC1=C(C#N)C(c2ccc(C#N)cc2C(O)CO)n2c(n[nH]c2=O)N1c1cccc(C(F)F)c1 |
| InChI | InChI=1S/C23H18F2N6O3/c1-12-18(10-27)20(16-6-5-13(9-26)7-17(16)19(33)11-32)31-22(28-29-23(31)34)30(12)15-4-2-3-14(8-15)21(24)25/h2-8,19-21,32-33H,11H2,1H3,(H,29,34) |
| InChIKey | KLJJIAFZEWOABW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 141.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |