C26H21N5O3 — CID 118556395
1-(oxetan-3-ylmethyl)-N-[4-(4-oxo-3H-phthalazin-1-yl)phenyl]indazole-3-carboxamide (PubChem CID 118556395) has the molecular formula C26H21N5O3 and a molecular weight of 451.49 g/mol. Its IUPAC name is 1-(oxetan-3-ylmethyl)-N-[4-(4-oxo-3H-phthalazin-1-yl)phenyl]indazole-3-carboxamide.
| Compound Name | 1-(oxetan-3-ylmethyl)-N-[4-(4-oxo-3H-phthalazin-1-yl)phenyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 118556395 |
| Molecular Formula | C26H21N5O3 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 1-(oxetan-3-ylmethyl)-N-[4-(4-oxo-3H-phthalazin-1-yl)phenyl]indazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(-c2n[nH]c(=O)c3ccccc23)cc1)c1nn(CC2COC2)c2ccccc12 |
| InChI | InChI=1S/C26H21N5O3/c32-25-20-6-2-1-5-19(20)23(28-29-25)17-9-11-18(12-10-17)27-26(33)24-21-7-3-4-8-22(21)31(30-24)13-16-14-34-15-16/h1-12,16H,13-15H2,(H,27,33)(H,29,32) |
| InChIKey | CDZBIOFVNILLDX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |