C25H21N5O3 — CID 118556425
1-(2-hydroxypropyl)-N-[4-(4-oxo-3H-phthalazin-1-yl)phenyl]indazole-3-carboxamide (PubChem CID 118556425) has the molecular formula C25H21N5O3 and a molecular weight of 439.48 g/mol. Its IUPAC name is 1-(2-hydroxypropyl)-N-[4-(4-oxo-3H-phthalazin-1-yl)phenyl]indazole-3-carboxamide.
| Compound Name | 1-(2-hydroxypropyl)-N-[4-(4-oxo-3H-phthalazin-1-yl)phenyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 118556425 |
| Molecular Formula | C25H21N5O3 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 1-(2-hydroxypropyl)-N-[4-(4-oxo-3H-phthalazin-1-yl)phenyl]indazole-3-carboxamide |
| SMILES | CC(O)Cn1nc(C(=O)Nc2ccc(-c3n[nH]c(=O)c4ccccc34)cc2)c2ccccc21 |
| InChI | InChI=1S/C25H21N5O3/c1-15(31)14-30-21-9-5-4-8-20(21)23(29-30)25(33)26-17-12-10-16(11-13-17)22-18-6-2-3-7-19(18)24(32)28-27-22/h2-13,15,31H,14H2,1H3,(H,26,33)(H,28,32) |
| InChIKey | MHCGTDFULJSJMX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |