C24H30BN3O4 — CID 123850291
1-(3-hydroxybutyl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indazole-3-carboxamide (PubChem CID 123850291) has the molecular formula C24H30BN3O4 and a molecular weight of 435.33 g/mol. Its IUPAC name is 1-(3-hydroxybutyl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indazole-3-carboxamide.
| Compound Name | 1-(3-hydroxybutyl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 123850291 |
| Molecular Formula | C24H30BN3O4 |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 1-(3-hydroxybutyl)-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indazole-3-carboxamide |
| SMILES | CC(O)CCn1nc(C(=O)Nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)c2ccccc21 |
| InChI | InChI=1S/C24H30BN3O4/c1-16(29)14-15-28-20-9-7-6-8-19(20)21(27-28)22(30)26-18-12-10-17(11-13-18)25-31-23(2,3)24(4,5)32-25/h6-13,16,29H,14-15H2,1-5H3,(H,26,30) |
| InChIKey | KFJBNLQIKGBNAP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|