C21H22O2 — CID 11855726
(3aR,4R,9bR)-6-ethenyl-4-(4-hydroxyphenyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalen-8-ol (PubChem CID 11855726) has the molecular formula C21H22O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is (3aR,4R,9bR)-6-ethenyl-4-(4-hydroxyphenyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalen-8-ol.
| Compound Name | (3aR,4R,9bR)-6-ethenyl-4-(4-hydroxyphenyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalen-8-ol |
|---|---|
| PubChem CID | 11855726 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (3aR,4R,9bR)-6-ethenyl-4-(4-hydroxyphenyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalen-8-ol |
| SMILES | C=Cc1cc(O)cc2c1C[C@@H](c1ccc(O)cc1)[C@H]1CCC[C@@H]21 |
| InChI | InChI=1S/C21H22O2/c1-2-13-10-16(23)11-21-18-5-3-4-17(18)20(12-19(13)21)14-6-8-15(22)9-7-14/h2,6-11,17-18,20,22-23H,1,3-5,12H2/t17-,18+,20-/m0/s1 |
| InChIKey | YCYUNFATCDZICY-NSHGMRRFSA-N |
| XLogP | 4.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |