C23H20N2O4 — CID 118559103
2-[4-[5-(2,4-dimethoxyphenyl)benzimidazol-1-yl]phenyl]acetic acid (PubChem CID 118559103) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is 2-[4-[5-(2,4-dimethoxyphenyl)benzimidazol-1-yl]phenyl]acetic acid.
| Compound Name | 2-[4-[5-(2,4-dimethoxyphenyl)benzimidazol-1-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 118559103 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2-[4-[5-(2,4-dimethoxyphenyl)benzimidazol-1-yl]phenyl]acetic acid |
| SMILES | COc1ccc(-c2ccc3c(c2)ncn3-c2ccc(CC(=O)O)cc2)c(OC)c1 |
| InChI | InChI=1S/C23H20N2O4/c1-28-18-8-9-19(22(13-18)29-2)16-5-10-21-20(12-16)24-14-25(21)17-6-3-15(4-7-17)11-23(26)27/h3-10,12-14H,11H2,1-2H3,(H,26,27) |
| InChIKey | SEHDMZUVDLOUOM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |