C20H18N2O3 — CID 170038717
2-[4-(5-pent-4-enoylbenzimidazol-1-yl)phenyl]acetic acid (PubChem CID 170038717) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-[4-(5-pent-4-enoylbenzimidazol-1-yl)phenyl]acetic acid.
| Compound Name | 2-[4-(5-pent-4-enoylbenzimidazol-1-yl)phenyl]acetic acid |
|---|---|
| PubChem CID | 170038717 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-[4-(5-pent-4-enoylbenzimidazol-1-yl)phenyl]acetic acid |
| SMILES | C=CCCC(=O)c1ccc2c(c1)ncn2-c1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C20H18N2O3/c1-2-3-4-19(23)15-7-10-18-17(12-15)21-13-22(18)16-8-5-14(6-9-16)11-20(24)25/h2,5-10,12-13H,1,3-4,11H2,(H,24,25) |
| InChIKey | MKCMPWUCSUPPIH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|