C22H18N2O4S — CID 118559156
2-[4-[5-(4-methylsulfonylphenyl)benzimidazol-1-yl]phenyl]acetic acid (PubChem CID 118559156) has the molecular formula C22H18N2O4S and a molecular weight of 406.46 g/mol. Its IUPAC name is 2-[4-[5-(4-methylsulfonylphenyl)benzimidazol-1-yl]phenyl]acetic acid.
| Compound Name | 2-[4-[5-(4-methylsulfonylphenyl)benzimidazol-1-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 118559156 |
| Molecular Formula | C22H18N2O4S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 2-[4-[5-(4-methylsulfonylphenyl)benzimidazol-1-yl]phenyl]acetic acid |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc3c(c2)ncn3-c2ccc(CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C22H18N2O4S/c1-29(27,28)19-9-4-16(5-10-19)17-6-11-21-20(13-17)23-14-24(21)18-7-2-15(3-8-18)12-22(25)26/h2-11,13-14H,12H2,1H3,(H,25,26) |
| InChIKey | GHUWDDBLAHNIMD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |