C23H20N2O4S2 — CID 118566470
sulfanylmethyl 2-[4-[5-(4-methylsulfonylphenyl)benzimidazol-1-yl]phenyl]acetate (PubChem CID 118566470) has the molecular formula C23H20N2O4S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is sulfanylmethyl 2-[4-[5-(4-methylsulfonylphenyl)benzimidazol-1-yl]phenyl]acetate.
| Compound Name | sulfanylmethyl 2-[4-[5-(4-methylsulfonylphenyl)benzimidazol-1-yl]phenyl]acetate |
|---|---|
| PubChem CID | 118566470 |
| Molecular Formula | C23H20N2O4S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | sulfanylmethyl 2-[4-[5-(4-methylsulfonylphenyl)benzimidazol-1-yl]phenyl]acetate |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc3c(c2)ncn3-c2ccc(CC(=O)OCS)cc2)cc1 |
| InChI | InChI=1S/C23H20N2O4S2/c1-31(27,28)20-9-4-17(5-10-20)18-6-11-22-21(13-18)24-14-25(22)19-7-2-16(3-8-19)12-23(26)29-15-30/h2-11,13-14,30H,12,15H2,1H3 |
| InChIKey | BSMWCWDGKKLLQH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 78.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|