C24H22N2O2 — CID 158587879
3-(2-methoxyphenyl)-1-[1-(3-methylphenyl)benzimidazol-5-yl]propan-1-one (PubChem CID 158587879) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-1-[1-(3-methylphenyl)benzimidazol-5-yl]propan-1-one.
| Compound Name | 3-(2-methoxyphenyl)-1-[1-(3-methylphenyl)benzimidazol-5-yl]propan-1-one |
|---|---|
| PubChem CID | 158587879 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 3-(2-methoxyphenyl)-1-[1-(3-methylphenyl)benzimidazol-5-yl]propan-1-one |
| SMILES | COc1ccccc1CCC(=O)c1ccc2c(c1)ncn2-c1cccc(C)c1 |
| InChI | InChI=1S/C24H22N2O2/c1-17-6-5-8-20(14-17)26-16-25-21-15-19(10-12-22(21)26)23(27)13-11-18-7-3-4-9-24(18)28-2/h3-10,12,14-16H,11,13H2,1-2H3 |
| InChIKey | RQHNDTOAXYUKTC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |