C23H31F3N3O5P — CID 11856071
[2-[[7-(cyclohexylamino)-6-fluoro-4-oxo-1-pentan-3-ylquinoline-3-carbonyl]amino]-2,2-difluoroethyl]phosphonic acid (PubChem CID 11856071) has the molecular formula C23H31F3N3O5P and a molecular weight of 517.49 g/mol. Its IUPAC name is [2-[[7-(cyclohexylamino)-6-fluoro-4-oxo-1-pentan-3-ylquinoline-3-carbonyl]amino]-2,2-difluoroethyl]phosphonic acid.
| Compound Name | [2-[[7-(cyclohexylamino)-6-fluoro-4-oxo-1-pentan-3-ylquinoline-3-carbonyl]amino]-2,2-difluoroethyl]phosphonic acid |
|---|---|
| PubChem CID | 11856071 |
| Molecular Formula | C23H31F3N3O5P |
| Molecular Weight | 517.49 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | [2-[[7-(cyclohexylamino)-6-fluoro-4-oxo-1-pentan-3-ylquinoline-3-carbonyl]amino]-2,2-difluoroethyl]phosphonic acid |
| SMILES | CCC(CC)n1cc(C(=O)NC(F)(F)CP(=O)(O)O)c(=O)c2cc(F)c(NC3CCCCC3)cc21 |
| InChI | InChI=1S/C23H31F3N3O5P/c1-3-15(4-2)29-12-17(22(31)28-23(25,26)13-35(32,33)34)21(30)16-10-18(24)19(11-20(16)29)27-14-8-6-5-7-9-14/h10-12,14-15,27H,3-9,13H2,1-2H3,(H,28,31)(H2,32,33,34) |
| InChIKey | YAFXDANJDYLUQO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|