C30H35BrFN3O3 — CID 143677036
N-[1-(4-bromophenyl)-3-oxopropyl]-7-(cyclohexylamino)-6-fluoro-4-oxo-1-pentan-3-ylquinoline-3-carboxamide (PubChem CID 143677036) has the molecular formula C30H35BrFN3O3 and a molecular weight of 584.53 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-3-oxopropyl]-7-(cyclohexylamino)-6-fluoro-4-oxo-1-pentan-3-ylquinoline-3-carboxamide.
| Compound Name | N-[1-(4-bromophenyl)-3-oxopropyl]-7-(cyclohexylamino)-6-fluoro-4-oxo-1-pentan-3-ylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 143677036 |
| Molecular Formula | C30H35BrFN3O3 |
| Molecular Weight | 584.53 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | N-[1-(4-bromophenyl)-3-oxopropyl]-7-(cyclohexylamino)-6-fluoro-4-oxo-1-pentan-3-ylquinoline-3-carboxamide |
| SMILES | CCC(CC)n1cc(C(=O)NC(CC=O)c2ccc(Br)cc2)c(=O)c2cc(F)c(NC3CCCCC3)cc21 |
| InChI | InChI=1S/C30H35BrFN3O3/c1-3-22(4-2)35-18-24(30(38)34-26(14-15-36)19-10-12-20(31)13-11-19)29(37)23-16-25(32)27(17-28(23)35)33-21-8-6-5-7-9-21/h10-13,15-18,21-22,26,33H,3-9,14H2,1-2H3,(H,34,38) |
| InChIKey | LZNOHACOQGDUDE-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.53 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|