C22H29FN2O3 — CID 118619688
7-(cyclohexylamino)-6-fluoro-5-methyl-4-oxo-1-pentan-3-ylquinoline-3-carboxylic acid (PubChem CID 118619688) has the molecular formula C22H29FN2O3 and a molecular weight of 388.48 g/mol. Its IUPAC name is 7-(cyclohexylamino)-6-fluoro-5-methyl-4-oxo-1-pentan-3-ylquinoline-3-carboxylic acid.
| Compound Name | 7-(cyclohexylamino)-6-fluoro-5-methyl-4-oxo-1-pentan-3-ylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 118619688 |
| Molecular Formula | C22H29FN2O3 |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 7-(cyclohexylamino)-6-fluoro-5-methyl-4-oxo-1-pentan-3-ylquinoline-3-carboxylic acid |
| SMILES | CCC(CC)n1cc(C(=O)O)c(=O)c2c(C)c(F)c(NC3CCCCC3)cc21 |
| InChI | InChI=1S/C22H29FN2O3/c1-4-15(5-2)25-12-16(22(27)28)21(26)19-13(3)20(23)17(11-18(19)25)24-14-9-7-6-8-10-14/h11-12,14-15,24H,4-10H2,1-3H3,(H,27,28) |
| InChIKey | SLOJJWCDKHXBQH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |