C28H26N2O4 — CID 118561130
2-[3-[(4-methylphenyl)carbamoyl]-4-piperidin-1-ylphenyl]-1-benzofuran-5-carboxylic acid (PubChem CID 118561130) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-[3-[(4-methylphenyl)carbamoyl]-4-piperidin-1-ylphenyl]-1-benzofuran-5-carboxylic acid.
| Compound Name | 2-[3-[(4-methylphenyl)carbamoyl]-4-piperidin-1-ylphenyl]-1-benzofuran-5-carboxylic acid |
|---|---|
| PubChem CID | 118561130 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 2-[3-[(4-methylphenyl)carbamoyl]-4-piperidin-1-ylphenyl]-1-benzofuran-5-carboxylic acid |
| SMILES | Cc1ccc(NC(=O)c2cc(-c3cc4cc(C(=O)O)ccc4o3)ccc2N2CCCCC2)cc1 |
| InChI | InChI=1S/C28H26N2O4/c1-18-5-9-22(10-6-18)29-27(31)23-16-19(7-11-24(23)30-13-3-2-4-14-30)26-17-21-15-20(28(32)33)8-12-25(21)34-26/h5-12,15-17H,2-4,13-14H2,1H3,(H,29,31)(H,32,33) |
| InChIKey | ILYKTXZRZQXZKF-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |