C18H25ClN4O3 — CID 118561998
(3S,8aS)-N-(4-chlorophenyl)-3-[[(2S)-2-(methylamino)propyl]amino]-4-oxo-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]oxazine-6-carboxamide (PubChem CID 118561998) has the molecular formula C18H25ClN4O3 and a molecular weight of 380.88 g/mol. Its IUPAC name is (3S,8aS)-N-(4-chlorophenyl)-3-[[(2S)-2-(methylamino)propyl]amino]-4-oxo-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]oxazine-6-carboxamide.
| Compound Name | (3S,8aS)-N-(4-chlorophenyl)-3-[[(2S)-2-(methylamino)propyl]amino]-4-oxo-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]oxazine-6-carboxamide |
|---|---|
| PubChem CID | 118561998 |
| Molecular Formula | C18H25ClN4O3 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (3S,8aS)-N-(4-chlorophenyl)-3-[[(2S)-2-(methylamino)propyl]amino]-4-oxo-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]oxazine-6-carboxamide |
| SMILES | CN[C@@H](C)CN[C@H]1CO[C@H]2CCC(C(=O)Nc3ccc(Cl)cc3)N2C1=O |
| InChI | InChI=1S/C18H25ClN4O3/c1-11(20-2)9-21-14-10-26-16-8-7-15(23(16)18(14)25)17(24)22-13-5-3-12(19)4-6-13/h3-6,11,14-16,20-21H,7-10H2,1-2H3,(H,22,24)/t11-,14-,15?,16-/m0/s1 |
| InChIKey | JJNRVJWXNOFOSG-OLSVDGPUSA-N |
| XLogP | 1.19 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |