C15H19N3O3 — CID 155188222
(6S)-3-methyl-4-oxo-N'-phenyl-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]oxazine-6-carbohydrazide (PubChem CID 155188222) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is (6S)-3-methyl-4-oxo-N'-phenyl-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]oxazine-6-carbohydrazide.
| Compound Name | (6S)-3-methyl-4-oxo-N'-phenyl-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]oxazine-6-carbohydrazide |
|---|---|
| PubChem CID | 155188222 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | (6S)-3-methyl-4-oxo-N'-phenyl-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]oxazine-6-carbohydrazide |
| SMILES | CC1COC2CC[C@@H](C(=O)NNc3ccccc3)N2C1=O |
| InChI | InChI=1S/C15H19N3O3/c1-10-9-21-13-8-7-12(18(13)15(10)20)14(19)17-16-11-5-3-2-4-6-11/h2-6,10,12-13,16H,7-9H2,1H3,(H,17,19)/t10?,12-,13?/m0/s1 |
| InChIKey | RAKMIFWUXVOMPD-YDGIUTOCSA-N |
| XLogP | 1.11 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|