C12H14N2O2 — CID 118562850
methyl (2S,3aS,8bR)-1,2,3,3a,4,8b-hexahydropyrrolo[2,3-b]indole-2-carboxylate (PubChem CID 118562850) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is methyl (2S,3aS,8bR)-1,2,3,3a,4,8b-hexahydropyrrolo[2,3-b]indole-2-carboxylate.
| Compound Name | methyl (2S,3aS,8bR)-1,2,3,3a,4,8b-hexahydropyrrolo[2,3-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 118562850 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | methyl (2S,3aS,8bR)-1,2,3,3a,4,8b-hexahydropyrrolo[2,3-b]indole-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2c3ccccc3N[C@@H]2N1 |
| InChI | InChI=1S/C12H14N2O2/c1-16-12(15)10-6-8-7-4-2-3-5-9(7)13-11(8)14-10/h2-5,8,10-11,13-14H,6H2,1H3/t8-,10+,11-/m1/s1 |
| InChIKey | RONQGGDOJAROCD-DVVUODLYSA-N |
| XLogP | 1.06 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |