C14H18N2O3 — CID 2752416
(1R,3S)-1-(hydroxymethyl)-1-methyl-2,3,4,4a,9,9a-hexahydropyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 2752416) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is (1R,3S)-1-(hydroxymethyl)-1-methyl-2,3,4,4a,9,9a-hexahydropyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | (1R,3S)-1-(hydroxymethyl)-1-methyl-2,3,4,4a,9,9a-hexahydropyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 2752416 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (1R,3S)-1-(hydroxymethyl)-1-methyl-2,3,4,4a,9,9a-hexahydropyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | C[C@@]1(CO)N[C@H](C(=O)O)CC2c3ccccc3NC21 |
| InChI | InChI=1S/C14H18N2O3/c1-14(7-17)12-9(6-11(16-14)13(18)19)8-4-2-3-5-10(8)15-12/h2-5,9,11-12,15-17H,6-7H2,1H3,(H,18,19)/t9?,11-,12?,14-/m0/s1 |
| InChIKey | VFBFHQPANIJOSR-POAFFCOJSA-N |
| XLogP | 0.76 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |