C11H9NO7 — CID 118563823
1-(7-nitro-2-oxo-1,3-benzodioxol-5-yl)ethyl acetate (PubChem CID 118563823) has the molecular formula C11H9NO7 and a molecular weight of 267.19 g/mol. Its IUPAC name is 1-(7-nitro-2-oxo-1,3-benzodioxol-5-yl)ethyl acetate.
| Compound Name | 1-(7-nitro-2-oxo-1,3-benzodioxol-5-yl)ethyl acetate |
|---|---|
| PubChem CID | 118563823 |
| Molecular Formula | C11H9NO7 |
| Molecular Weight | 267.19 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 1-(7-nitro-2-oxo-1,3-benzodioxol-5-yl)ethyl acetate |
| SMILES | CC(=O)OC(C)c1cc([N+](=O)[O-])c2oc(=O)oc2c1 |
| InChI | InChI=1S/C11H9NO7/c1-5(17-6(2)13)7-3-8(12(15)16)10-9(4-7)18-11(14)19-10/h3-5H,1-2H3 |
| InChIKey | IFDIVVYKTXDZDC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 112.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.19 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|