C20H29BrN4O2 — CID 11856529
3-[[5-bromo-2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]amino]adamantan-1-ol (PubChem CID 11856529) has the molecular formula C20H29BrN4O2 and a molecular weight of 437.38 g/mol. Its IUPAC name is 3-[[5-bromo-2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]amino]adamantan-1-ol.
| Compound Name | 3-[[5-bromo-2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]amino]adamantan-1-ol |
|---|---|
| PubChem CID | 11856529 |
| Molecular Formula | C20H29BrN4O2 |
| Molecular Weight | 437.38 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 3-[[5-bromo-2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]amino]adamantan-1-ol |
| SMILES | OC1CCC(Nc2ncc(Br)c(NC34CC5CC(CC(O)(C5)C3)C4)n2)CC1 |
| InChI | InChI=1S/C20H29BrN4O2/c21-16-10-22-18(23-14-1-3-15(26)4-2-14)24-17(16)25-19-6-12-5-13(7-19)9-20(27,8-12)11-19/h10,12-15,26-27H,1-9,11H2,(H2,22,23,24,25) |
| InChIKey | FGYLHONNVFJRIG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |