C19H27N5O — CID 118568197
1-[3-[[2-amino-6-(2,5-dimethylphenyl)-1,4-dihydropyrimidin-4-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 118568197) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is 1-[3-[[2-amino-6-(2,5-dimethylphenyl)-1,4-dihydropyrimidin-4-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[2-amino-6-(2,5-dimethylphenyl)-1,4-dihydropyrimidin-4-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 118568197 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 1-[3-[[2-amino-6-(2,5-dimethylphenyl)-1,4-dihydropyrimidin-4-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | Cc1ccc(C)c(C2=CC(NCCCN3CCCC3=O)N=C(N)N2)c1 |
| InChI | InChI=1S/C19H27N5O/c1-13-6-7-14(2)15(11-13)16-12-17(23-19(20)22-16)21-8-4-10-24-9-3-5-18(24)25/h6-7,11-12,17,21H,3-5,8-10H2,1-2H3,(H3,20,22,23) |
| InChIKey | AYOOFCWQVVRYAL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|