C18H22F3N5O — CID 118568203
1-[3-[[2-amino-6-[2-(trifluoromethyl)phenyl]-1,4-dihydropyrimidin-4-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 118568203) has the molecular formula C18H22F3N5O and a molecular weight of 381.40 g/mol. Its IUPAC name is 1-[3-[[2-amino-6-[2-(trifluoromethyl)phenyl]-1,4-dihydropyrimidin-4-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[2-amino-6-[2-(trifluoromethyl)phenyl]-1,4-dihydropyrimidin-4-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 118568203 |
| Molecular Formula | C18H22F3N5O |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 1-[3-[[2-amino-6-[2-(trifluoromethyl)phenyl]-1,4-dihydropyrimidin-4-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | NC1=NC(NCCCN2CCCC2=O)C=C(c2ccccc2C(F)(F)F)N1 |
| InChI | InChI=1S/C18H22F3N5O/c19-18(20,21)13-6-2-1-5-12(13)14-11-15(25-17(22)24-14)23-8-4-10-26-9-3-7-16(26)27/h1-2,5-6,11,15,23H,3-4,7-10H2,(H3,22,24,25) |
| InChIKey | CCSXNSUGDVCNBZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|