C18H23F3N2O — CID 97109948
1-[3-[[(S)-cyclopropyl-[3-(trifluoromethyl)phenyl]methyl]amino]propyl]pyrrolidin-2-one (PubChem CID 97109948) has the molecular formula C18H23F3N2O and a molecular weight of 340.39 g/mol. Its IUPAC name is 1-[3-[[(S)-cyclopropyl-[3-(trifluoromethyl)phenyl]methyl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[(S)-cyclopropyl-[3-(trifluoromethyl)phenyl]methyl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 97109948 |
| Molecular Formula | C18H23F3N2O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-[3-[[(S)-cyclopropyl-[3-(trifluoromethyl)phenyl]methyl]amino]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCN[C@H](c1cccc(C(F)(F)F)c1)C1CC1 |
| InChI | InChI=1S/C18H23F3N2O/c19-18(20,21)15-5-1-4-14(12-15)17(13-7-8-13)22-9-3-11-23-10-2-6-16(23)24/h1,4-5,12-13,17,22H,2-3,6-11H2/t17-/m0/s1 |
| InChIKey | PURHSVOOGLGGSB-KRWDZBQOSA-N |
| XLogP | 3.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|