C15H17F3N2O — CID 124881063
2-[[(R)-oxan-4-yl-[3-(trifluoromethyl)phenyl]methyl]amino]acetonitrile (PubChem CID 124881063) has the molecular formula C15H17F3N2O and a molecular weight of 298.31 g/mol. Its IUPAC name is 2-[[(R)-oxan-4-yl-[3-(trifluoromethyl)phenyl]methyl]amino]acetonitrile.
| Compound Name | 2-[[(R)-oxan-4-yl-[3-(trifluoromethyl)phenyl]methyl]amino]acetonitrile |
|---|---|
| PubChem CID | 124881063 |
| Molecular Formula | C15H17F3N2O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-[[(R)-oxan-4-yl-[3-(trifluoromethyl)phenyl]methyl]amino]acetonitrile |
| SMILES | N#CCN[C@@H](c1cccc(C(F)(F)F)c1)C1CCOCC1 |
| InChI | InChI=1S/C15H17F3N2O/c16-15(17,18)13-3-1-2-12(10-13)14(20-7-6-19)11-4-8-21-9-5-11/h1-3,10-11,14,20H,4-5,7-9H2/t14-/m1/s1 |
| InChIKey | DPWVPAQLSGURIU-CQSZACIVSA-N |
| XLogP | 3.29 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|