C17H20N4O3 — CID 3871049
2-(2-aminophenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3-oxazole-4-carboxamide (PubChem CID 3871049) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-(2-aminophenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(2-aminophenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3871049 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-(2-aminophenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3-oxazole-4-carboxamide |
| SMILES | Nc1ccccc1-c1nc(C(=O)NCCCN2CCCC2=O)co1 |
| InChI | InChI=1S/C17H20N4O3/c18-13-6-2-1-5-12(13)17-20-14(11-24-17)16(23)19-8-4-10-21-9-3-7-15(21)22/h1-2,5-6,11H,3-4,7-10,18H2,(H,19,23) |
| InChIKey | ZPVFGYKHPNSSIJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|