C18H16BrClN2O3 — CID 118570430
[(3R)-3-chloro-2-oxo-1-phenylpyrrolidin-3-yl] N-[(3-bromophenyl)methyl]carbamate (PubChem CID 118570430) has the molecular formula C18H16BrClN2O3 and a molecular weight of 423.69 g/mol. Its IUPAC name is [(3R)-3-chloro-2-oxo-1-phenylpyrrolidin-3-yl] N-[(3-bromophenyl)methyl]carbamate.
| Compound Name | [(3R)-3-chloro-2-oxo-1-phenylpyrrolidin-3-yl] N-[(3-bromophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 118570430 |
| Molecular Formula | C18H16BrClN2O3 |
| Molecular Weight | 423.69 g/mol |
| Exact Mass | 422.00 |
| IUPAC Name | [(3R)-3-chloro-2-oxo-1-phenylpyrrolidin-3-yl] N-[(3-bromophenyl)methyl]carbamate |
| SMILES | O=C(NCc1cccc(Br)c1)O[C@@]1(Cl)CCN(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H16BrClN2O3/c19-14-6-4-5-13(11-14)12-21-17(24)25-18(20)9-10-22(16(18)23)15-7-2-1-3-8-15/h1-8,11H,9-10,12H2,(H,21,24)/t18-/m0/s1 |
| InChIKey | JIUSMCSKEKKWHM-SFHVURJKSA-N |
| XLogP | 4.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.69 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|