C19H18F2N2O5 — CID 118570533
[(3S)-3-hydroxy-2-oxo-1-phenylpyrrolidin-3-yl] N-[[3-(difluoromethoxy)phenyl]methyl]carbamate (PubChem CID 118570533) has the molecular formula C19H18F2N2O5 and a molecular weight of 392.36 g/mol. Its IUPAC name is [(3S)-3-hydroxy-2-oxo-1-phenylpyrrolidin-3-yl] N-[[3-(difluoromethoxy)phenyl]methyl]carbamate.
| Compound Name | [(3S)-3-hydroxy-2-oxo-1-phenylpyrrolidin-3-yl] N-[[3-(difluoromethoxy)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 118570533 |
| Molecular Formula | C19H18F2N2O5 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | [(3S)-3-hydroxy-2-oxo-1-phenylpyrrolidin-3-yl] N-[[3-(difluoromethoxy)phenyl]methyl]carbamate |
| SMILES | O=C(NCc1cccc(OC(F)F)c1)O[C@@]1(O)CCN(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H18F2N2O5/c20-17(21)27-15-8-4-5-13(11-15)12-22-18(25)28-19(26)9-10-23(16(19)24)14-6-2-1-3-7-14/h1-8,11,17,26H,9-10,12H2,(H,22,25)/t19-/m0/s1 |
| InChIKey | CVADJSCKNFVVIQ-IBGZPJMESA-N |
| XLogP | 2.64 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|