C18H16BrFN2O4 — CID 118570309
[(3S)-1-(4-fluorophenyl)-3-hydroxy-2-oxopyrrolidin-3-yl] N-[(3-bromophenyl)methyl]carbamate (PubChem CID 118570309) has the molecular formula C18H16BrFN2O4 and a molecular weight of 423.24 g/mol. Its IUPAC name is [(3S)-1-(4-fluorophenyl)-3-hydroxy-2-oxopyrrolidin-3-yl] N-[(3-bromophenyl)methyl]carbamate.
| Compound Name | [(3S)-1-(4-fluorophenyl)-3-hydroxy-2-oxopyrrolidin-3-yl] N-[(3-bromophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 118570309 |
| Molecular Formula | C18H16BrFN2O4 |
| Molecular Weight | 423.24 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | [(3S)-1-(4-fluorophenyl)-3-hydroxy-2-oxopyrrolidin-3-yl] N-[(3-bromophenyl)methyl]carbamate |
| SMILES | O=C(NCc1cccc(Br)c1)O[C@@]1(O)CCN(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C18H16BrFN2O4/c19-13-3-1-2-12(10-13)11-21-17(24)26-18(25)8-9-22(16(18)23)15-6-4-14(20)5-7-15/h1-7,10,25H,8-9,11H2,(H,21,24)/t18-/m0/s1 |
| InChIKey | DMSTWXPSQSBDMW-SFHVURJKSA-N |
| XLogP | 2.94 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|