C18H17BrF2N2O3 — CID 162038492
(3S)-N-[(3-bromophenyl)methyl]-1-(2,4-difluorocyclohexa-1,3-dien-1-yl)-3-hydroxy-2-oxopyrrolidine-3-carboxamide (PubChem CID 162038492) has the molecular formula C18H17BrF2N2O3 and a molecular weight of 427.25 g/mol. Its IUPAC name is (3S)-N-[(3-bromophenyl)methyl]-1-(2,4-difluorocyclohexa-1,3-dien-1-yl)-3-hydroxy-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[(3-bromophenyl)methyl]-1-(2,4-difluorocyclohexa-1,3-dien-1-yl)-3-hydroxy-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 162038492 |
| Molecular Formula | C18H17BrF2N2O3 |
| Molecular Weight | 427.25 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | (3S)-N-[(3-bromophenyl)methyl]-1-(2,4-difluorocyclohexa-1,3-dien-1-yl)-3-hydroxy-2-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1cccc(Br)c1)[C@@]1(O)CCN(C2=C(F)C=C(F)CC2)C1=O |
| InChI | InChI=1S/C18H17BrF2N2O3/c19-12-3-1-2-11(8-12)10-22-16(24)18(26)6-7-23(17(18)25)15-5-4-13(20)9-14(15)21/h1-3,8-9,26H,4-7,10H2,(H,22,24)/t18-/m0/s1 |
| InChIKey | YWYPJGXRYCAKCL-SFHVURJKSA-N |
| XLogP | 2.86 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|