C20H21F2N2O4P — CID 170650201
(3R)-N-[(3,5-difluorophenyl)methyl]-1-(4-dimethylphosphorylphenyl)-3-hydroxy-2-oxopyrrolidine-3-carboxamide (PubChem CID 170650201) has the molecular formula C20H21F2N2O4P and a molecular weight of 422.37 g/mol. Its IUPAC name is (3R)-N-[(3,5-difluorophenyl)methyl]-1-(4-dimethylphosphorylphenyl)-3-hydroxy-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[(3,5-difluorophenyl)methyl]-1-(4-dimethylphosphorylphenyl)-3-hydroxy-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 170650201 |
| Molecular Formula | C20H21F2N2O4P |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | (3R)-N-[(3,5-difluorophenyl)methyl]-1-(4-dimethylphosphorylphenyl)-3-hydroxy-2-oxopyrrolidine-3-carboxamide |
| SMILES | CP(C)(=O)c1ccc(N2CC[C@@](O)(C(=O)NCc3cc(F)cc(F)c3)C2=O)cc1 |
| InChI | InChI=1S/C20H21F2N2O4P/c1-29(2,28)17-5-3-16(4-6-17)24-8-7-20(27,19(24)26)18(25)23-12-13-9-14(21)11-15(22)10-13/h3-6,9-11,27H,7-8,12H2,1-2H3,(H,23,25)/t20-/m1/s1 |
| InChIKey | XVAOUYTZOYPRJF-HXUWFJFHSA-N |
| XLogP | 2.00 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|