C19H15ClF4N2O4 — CID 118884373
(3S)-N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidine-3-carboxamide (PubChem CID 118884373) has the molecular formula C19H15ClF4N2O4 and a molecular weight of 446.78 g/mol. Its IUPAC name is (3S)-N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 118884373 |
| Molecular Formula | C19H15ClF4N2O4 |
| Molecular Weight | 446.78 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | (3S)-N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxo-1-[3-(trifluoromethoxy)phenyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1cc(F)cc(Cl)c1)[C@@]1(O)CCN(c2cccc(OC(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C19H15ClF4N2O4/c20-12-6-11(7-13(21)8-12)10-25-16(27)18(29)4-5-26(17(18)28)14-2-1-3-15(9-14)30-19(22,23)24/h1-3,6-9,29H,4-5,10H2,(H,25,27)/t18-/m0/s1 |
| InChIKey | BEYWWSCFIXJMMF-SFHVURJKSA-N |
| XLogP | 3.16 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.78 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|