C20H16ClF4N3O4 — CID 141376897
1-[3-[(3-chloro-5-fluorophenyl)methylcarbamoyl]-4-(trifluoromethyl)phenyl]-3-hydroxy-2-oxopyrrolidine-3-carboxamide (PubChem CID 141376897) has the molecular formula C20H16ClF4N3O4 and a molecular weight of 473.81 g/mol. Its IUPAC name is 1-[3-[(3-chloro-5-fluorophenyl)methylcarbamoyl]-4-(trifluoromethyl)phenyl]-3-hydroxy-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-[3-[(3-chloro-5-fluorophenyl)methylcarbamoyl]-4-(trifluoromethyl)phenyl]-3-hydroxy-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 141376897 |
| Molecular Formula | C20H16ClF4N3O4 |
| Molecular Weight | 473.81 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 1-[3-[(3-chloro-5-fluorophenyl)methylcarbamoyl]-4-(trifluoromethyl)phenyl]-3-hydroxy-2-oxopyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1(O)CCN(c2ccc(C(F)(F)F)c(C(=O)NCc3cc(F)cc(Cl)c3)c2)C1=O |
| InChI | InChI=1S/C20H16ClF4N3O4/c21-11-5-10(6-12(22)7-11)9-27-16(29)14-8-13(1-2-15(14)20(23,24)25)28-4-3-19(32,17(26)30)18(28)31/h1-2,5-8,32H,3-4,9H2,(H2,26,30)(H,27,29) |
| InChIKey | YINDARXAUUPMBB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.81 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|