C30H37ClFN2O4P — CID 175974265
(3S)-N-[(3-chloro-5-fluorophenyl)methyl]-1-(4-dicyclohexylphosphorylphenyl)-3-hydroxy-2-oxopyrrolidine-3-carboxamide (PubChem CID 175974265) has the molecular formula C30H37ClFN2O4P and a molecular weight of 575.06 g/mol. Its IUPAC name is (3S)-N-[(3-chloro-5-fluorophenyl)methyl]-1-(4-dicyclohexylphosphorylphenyl)-3-hydroxy-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[(3-chloro-5-fluorophenyl)methyl]-1-(4-dicyclohexylphosphorylphenyl)-3-hydroxy-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 175974265 |
| Molecular Formula | C30H37ClFN2O4P |
| Molecular Weight | 575.06 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | (3S)-N-[(3-chloro-5-fluorophenyl)methyl]-1-(4-dicyclohexylphosphorylphenyl)-3-hydroxy-2-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1cc(F)cc(Cl)c1)[C@@]1(O)CCN(c2ccc(P(=O)(C3CCCCC3)C3CCCCC3)cc2)C1=O |
| InChI | InChI=1S/C30H37ClFN2O4P/c31-22-17-21(18-23(32)19-22)20-33-28(35)30(37)15-16-34(29(30)36)24-11-13-27(14-12-24)39(38,25-7-3-1-4-8-25)26-9-5-2-6-10-26/h11-14,17-19,25-26,37H,1-10,15-16,20H2,(H,33,35)/t30-/m0/s1 |
| InChIKey | CTPDHHPNBJFLIU-PMERELPUSA-N |
| XLogP | 5.92 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.06 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|